About 7-aminonaphthalen-2-ol;hydrochloride
7-aminonaphthalen-2-ol;hydrochloride (PubChem CID 19986891) has the molecular formula C10H10ClNO
and a molecular weight of 195.65 g/mol. Its IUPAC name is 7-aminonaphthalen-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 7-aminonaphthalen-2-ol;hydrochloride |
| PubChem CID | 19986891 |
| Molecular Formula | C10H10ClNO |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 7-aminonaphthalen-2-ol;hydrochloride |
| SMILES | Cl.Nc1ccc2ccc(O)cc2c1 |
| InChI | InChI=1S/C10H9NO.ClH/c11-9-3-1-7-2-4-10(12)6-8(7)5-9;/h1-6,12H,11H2;1H |
| InChIKey | VDFLTUHMDULKQC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-aminonaphthalen-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-aminonaphthalen-2-ol;hydrochloride?
The IUPAC name of 7-aminonaphthalen-2-ol;hydrochloride (CID 19986891) is 7-aminonaphthalen-2-ol;hydrochloride.
What is the SMILES notation for 7-aminonaphthalen-2-ol;hydrochloride?
The canonical SMILES for 7-aminonaphthalen-2-ol;hydrochloride is Cl.Nc1ccc2ccc(O)cc2c1.
What is the InChIKey of 7-aminonaphthalen-2-ol;hydrochloride?
The InChIKey is VDFLTUHMDULKQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO.ClH/c11-9-3-1-7-2-4-10(12)6-8(7)5-9;/h1-6,12H,11H2;1H.
What are the key properties of 7-aminonaphthalen-2-ol;hydrochloride?
7-aminonaphthalen-2-ol;hydrochloride has a molecular weight of 195.65 g/mol, XLogP of 2.55, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-aminonaphthalen-2-ol;hydrochloride is sourced from PubChem (CID 19986891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).