C18H13NO4 — CID 134912266
2-(4-methoxyphenyl)-6-methylpyrano[3,2-g][1,3]benzoxazol-8-one (PubChem CID 134912266) has the molecular formula C18H13NO4 and a molecular weight of 307.31 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-6-methylpyrano[3,2-g][1,3]benzoxazol-8-one.
| Compound Name | 2-(4-methoxyphenyl)-6-methylpyrano[3,2-g][1,3]benzoxazol-8-one |
|---|---|
| PubChem CID | 134912266 |
| Molecular Formula | C18H13NO4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-(4-methoxyphenyl)-6-methylpyrano[3,2-g][1,3]benzoxazol-8-one |
| SMILES | COc1ccc(-c2nc3ccc4c(C)cc(=O)oc4c3o2)cc1 |
| InChI | InChI=1S/C18H13NO4/c1-10-9-15(20)22-16-13(10)7-8-14-17(16)23-18(19-14)11-3-5-12(21-2)6-4-11/h3-9H,1-2H3 |
| InChIKey | BGVHLESZAATZKM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 65.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|