C26H19N3O2 — CID 90967896
2-[2-(4-methoxyphenyl)ethenyl]-3-phenylpyrido[2,3-h]quinazolin-4-one (PubChem CID 90967896) has the molecular formula C26H19N3O2 and a molecular weight of 405.46 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)ethenyl]-3-phenylpyrido[2,3-h]quinazolin-4-one.
| Compound Name | 2-[2-(4-methoxyphenyl)ethenyl]-3-phenylpyrido[2,3-h]quinazolin-4-one |
|---|---|
| PubChem CID | 90967896 |
| Molecular Formula | C26H19N3O2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)ethenyl]-3-phenylpyrido[2,3-h]quinazolin-4-one |
| SMILES | COc1ccc(C=Cc2nc3c(ccc4ncccc43)c(=O)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H19N3O2/c1-31-20-12-9-18(10-13-20)11-16-24-28-25-21-8-5-17-27-23(21)15-14-22(25)26(30)29(24)19-6-3-2-4-7-19/h2-17H,1H3 |
| InChIKey | OGOWMQIYLYEUBO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|