C24H16N4O4 — CID 11133653
2-(4-methoxyphenyl)-3-(4-nitrophenyl)pyrido[2,3-h]quinazolin-4-one (PubChem CID 11133653) has the molecular formula C24H16N4O4 and a molecular weight of 424.42 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-3-(4-nitrophenyl)pyrido[2,3-h]quinazolin-4-one.
| Compound Name | 2-(4-methoxyphenyl)-3-(4-nitrophenyl)pyrido[2,3-h]quinazolin-4-one |
|---|---|
| PubChem CID | 11133653 |
| Molecular Formula | C24H16N4O4 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 2-(4-methoxyphenyl)-3-(4-nitrophenyl)pyrido[2,3-h]quinazolin-4-one |
| SMILES | COc1ccc(-c2nc3c(ccc4ncccc43)c(=O)n2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H16N4O4/c1-32-18-10-4-15(5-11-18)23-26-22-19-3-2-14-25-21(19)13-12-20(22)24(29)27(23)16-6-8-17(9-7-16)28(30)31/h2-14H,1H3 |
| InChIKey | QWZNNESLRGBEKS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|