C20H15N5O3S — CID 98172711
3-(4-methoxyphenyl)-4-(4-nitrophenyl)-N-pyrimidin-2-yl-1,3-thiazol-2-imine (PubChem CID 98172711) has the molecular formula C20H15N5O3S and a molecular weight of 405.44 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-4-(4-nitrophenyl)-N-pyrimidin-2-yl-1,3-thiazol-2-imine.
| Compound Name | 3-(4-methoxyphenyl)-4-(4-nitrophenyl)-N-pyrimidin-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 98172711 |
| Molecular Formula | C20H15N5O3S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 3-(4-methoxyphenyl)-4-(4-nitrophenyl)-N-pyrimidin-2-yl-1,3-thiazol-2-imine |
| SMILES | COc1ccc(-n2c(-c3ccc([N+](=O)[O-])cc3)csc2=Nc2ncccn2)cc1 |
| InChI | InChI=1S/C20H15N5O3S/c1-28-17-9-7-15(8-10-17)24-18(14-3-5-16(6-4-14)25(26)27)13-29-20(24)23-19-21-11-2-12-22-19/h2-13H,1H3 |
| InChIKey | XIGJVJMPAQVWBA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 95.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|