C15H10N4O4S — CID 139218619
3,4-bis(4-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 139218619) has the molecular formula C15H10N4O4S and a molecular weight of 342.34 g/mol. Its IUPAC name is 3,4-bis(4-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | 3,4-bis(4-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 139218619 |
| Molecular Formula | C15H10N4O4S |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 3,4-bis(4-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | [H]/N=c1\scc(-c2ccc([N+](=O)[O-])cc2)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H10N4O4S/c16-15-17(11-5-7-13(8-6-11)19(22)23)14(9-24-15)10-1-3-12(4-2-10)18(20)21/h1-9,16H/b16-15- |
| InChIKey | OIYDYENSMXUPIY-NXVVXOECSA-N |
| XLogP | 3.50 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|