C15H9N5O6 — CID 163725711
5-imino-1,3-bis(4-nitrophenyl)imidazolidine-2,4-dione (PubChem CID 163725711) has the molecular formula C15H9N5O6 and a molecular weight of 355.27 g/mol. Its IUPAC name is 5-imino-1,3-bis(4-nitrophenyl)imidazolidine-2,4-dione.
| Compound Name | 5-imino-1,3-bis(4-nitrophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 163725711 |
| Molecular Formula | C15H9N5O6 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 5-imino-1,3-bis(4-nitrophenyl)imidazolidine-2,4-dione |
| SMILES | [H]/N=C1\C(=O)N(c2ccc([N+](=O)[O-])cc2)C(=O)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H9N5O6/c16-13-14(21)18(10-3-7-12(8-4-10)20(25)26)15(22)17(13)9-1-5-11(6-2-9)19(23)24/h1-8,16H/b16-13+ |
| InChIKey | KVJOLDOTGJGVCV-DTQAZKPQSA-N |
| XLogP | 2.45 |
| TPSA | 150.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|