C17H11N3O5S — CID 18824601
4-[(5Z)-2-imino-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]benzoic acid (PubChem CID 18824601) has the molecular formula C17H11N3O5S and a molecular weight of 369.36 g/mol. Its IUPAC name is 4-[(5Z)-2-imino-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]benzoic acid.
| Compound Name | 4-[(5Z)-2-imino-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 18824601 |
| Molecular Formula | C17H11N3O5S |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 4-[(5Z)-2-imino-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]benzoic acid |
| SMILES | [H]/N=C1\S/C(=C\c2ccc([N+](=O)[O-])cc2)C(=O)N1c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H11N3O5S/c18-17-19(12-7-3-11(4-8-12)16(22)23)15(21)14(26-17)9-10-1-5-13(6-2-10)20(24)25/h1-9,18H,(H,22,23)/b14-9-,18-17- |
| InChIKey | QEQNMYRVHCWMMW-OHBFYCIKSA-N |
| XLogP | 3.35 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|