C17H11ClN2O3S — CID 18824600
4-[(5Z)-5-[(4-chlorophenyl)methylidene]-2-imino-4-oxo-1,3-thiazolidin-3-yl]benzoic acid (PubChem CID 18824600) has the molecular formula C17H11ClN2O3S and a molecular weight of 358.81 g/mol. Its IUPAC name is 4-[(5Z)-5-[(4-chlorophenyl)methylidene]-2-imino-4-oxo-1,3-thiazolidin-3-yl]benzoic acid.
| Compound Name | 4-[(5Z)-5-[(4-chlorophenyl)methylidene]-2-imino-4-oxo-1,3-thiazolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 18824600 |
| Molecular Formula | C17H11ClN2O3S |
| Molecular Weight | 358.81 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 4-[(5Z)-5-[(4-chlorophenyl)methylidene]-2-imino-4-oxo-1,3-thiazolidin-3-yl]benzoic acid |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(Cl)cc2)C(=O)N1c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H11ClN2O3S/c18-12-5-1-10(2-6-12)9-14-15(21)20(17(19)24-14)13-7-3-11(4-8-13)16(22)23/h1-9,19H,(H,22,23)/b14-9-,19-17- |
| InChIKey | APQYXVIMRIWBGD-YPFSYJIWSA-N |
| XLogP | 4.09 |
| TPSA | 81.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.81 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|