C22H14Cl2N2OS — CID 16633628
(5Z)-3-(3,4-dichlorophenyl)-2-imino-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 16633628) has the molecular formula C22H14Cl2N2OS and a molecular weight of 425.34 g/mol. Its IUPAC name is (5Z)-3-(3,4-dichlorophenyl)-2-imino-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(3,4-dichlorophenyl)-2-imino-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16633628 |
| Molecular Formula | C22H14Cl2N2OS |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | (5Z)-3-(3,4-dichlorophenyl)-2-imino-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(-c3ccccc3)cc2)C(=O)N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H14Cl2N2OS/c23-18-11-10-17(13-19(18)24)26-21(27)20(28-22(26)25)12-14-6-8-16(9-7-14)15-4-2-1-3-5-15/h1-13,25H/b20-12-,25-22- |
| InChIKey | BZNJHIBKQZHIKI-UZGKJVJGSA-N |
| XLogP | 6.72 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|