C16H10Cl2N2OS — CID 16633608
(5Z)-5-benzylidene-3-(3,4-dichlorophenyl)-2-imino-1,3-thiazolidin-4-one (PubChem CID 16633608) has the molecular formula C16H10Cl2N2OS and a molecular weight of 349.24 g/mol. Its IUPAC name is (5Z)-5-benzylidene-3-(3,4-dichlorophenyl)-2-imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-benzylidene-3-(3,4-dichlorophenyl)-2-imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16633608 |
| Molecular Formula | C16H10Cl2N2OS |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | (5Z)-5-benzylidene-3-(3,4-dichlorophenyl)-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\S/C(=C\c2ccccc2)C(=O)N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H10Cl2N2OS/c17-12-7-6-11(9-13(12)18)20-15(21)14(22-16(20)19)8-10-4-2-1-3-5-10/h1-9,19H/b14-8-,19-16- |
| InChIKey | PKTPVJKSPSZVQD-IAKJMAAOSA-N |
| XLogP | 5.05 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|