C17H11FN2O3S — CID 3319343
3-(1,3-benzodioxol-5-yl)-5-[(3-fluorophenyl)methylidene]-2-imino-1,3-thiazolidin-4-one (PubChem CID 3319343) has the molecular formula C17H11FN2O3S and a molecular weight of 342.35 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-5-[(3-fluorophenyl)methylidene]-2-imino-1,3-thiazolidin-4-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-5-[(3-fluorophenyl)methylidene]-2-imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3319343 |
| Molecular Formula | C17H11FN2O3S |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-5-[(3-fluorophenyl)methylidene]-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\SC(=Cc2cccc(F)c2)C(=O)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H11FN2O3S/c18-11-3-1-2-10(6-11)7-15-16(21)20(17(19)24-15)12-4-5-13-14(8-12)23-9-22-13/h1-8,19H,9H2/b15-7?,19-17- |
| InChIKey | MCKYWONHEWFZJK-CYXHFSBESA-N |
| XLogP | 3.61 |
| TPSA | 62.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|