C22H13N2O6S- — CID 2261539
3-[5-[(Z)-[3-(1,3-benzodioxol-5-yl)-2-imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 2261539) has the molecular formula C22H13N2O6S- and a molecular weight of 433.42 g/mol. Its IUPAC name is 3-[5-[(Z)-[3-(1,3-benzodioxol-5-yl)-2-imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | 3-[5-[(Z)-[3-(1,3-benzodioxol-5-yl)-2-imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 2261539 |
| Molecular Formula | C22H13N2O6S- |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 3-[5-[(Z)-[3-(1,3-benzodioxol-5-yl)-2-imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(-c3cccc(C(=O)[O-])c3)o2)C(=O)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H14N2O6S/c23-22-24(14-4-6-17-18(9-14)29-11-28-17)20(25)19(31-22)10-15-5-7-16(30-15)12-2-1-3-13(8-12)21(26)27/h1-10,23H,11H2,(H,26,27)/p-1/b19-10-,23-22- |
| InChIKey | ARXKWYLPICNGDP-DKMBIBFRSA-M |
| XLogP | 3.09 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|