C21H13FN2O4S — CID 1360799
3-(1,3-benzodioxol-5-yl)-5-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-2-imino-1,3-thiazolidin-4-one (PubChem CID 1360799) has the molecular formula C21H13FN2O4S and a molecular weight of 408.41 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-5-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-2-imino-1,3-thiazolidin-4-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-5-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-2-imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1360799 |
| Molecular Formula | C21H13FN2O4S |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-5-[[5-(4-fluorophenyl)furan-2-yl]methylidene]-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\SC(=Cc2ccc(-c3ccc(F)cc3)o2)C(=O)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H13FN2O4S/c22-13-3-1-12(2-4-13)16-8-6-15(28-16)10-19-20(25)24(21(23)29-19)14-5-7-17-18(9-14)27-11-26-17/h1-10,23H,11H2/b19-10?,23-21- |
| InChIKey | YLHPFFGZAIWFPI-LNWMIWDOSA-N |
| XLogP | 4.87 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|