C20H10Cl3FN2O2S — CID 4111598
3-(4-fluorophenyl)-2-imino-5-[[5-(2,4,5-trichlorophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 4111598) has the molecular formula C20H10Cl3FN2O2S and a molecular weight of 467.74 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-imino-5-[[5-(2,4,5-trichlorophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-(4-fluorophenyl)-2-imino-5-[[5-(2,4,5-trichlorophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4111598 |
| Molecular Formula | C20H10Cl3FN2O2S |
| Molecular Weight | 467.74 g/mol |
| Exact Mass | 465.95 |
| IUPAC Name | 3-(4-fluorophenyl)-2-imino-5-[[5-(2,4,5-trichlorophenyl)furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\SC(=Cc2ccc(-c3cc(Cl)c(Cl)cc3Cl)o2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H10Cl3FN2O2S/c21-14-9-16(23)15(22)8-13(14)17-6-5-12(28-17)7-18-19(27)26(20(25)29-18)11-3-1-10(24)2-4-11/h1-9,25H/b18-7?,25-20- |
| InChIKey | LOZHNEXCGAVVFD-XTOGTMOASA-N |
| XLogP | 7.10 |
| TPSA | 57.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.74 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|