C16H9ClFN5O3S — CID 1258938
(5Z)-3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methylidene]-2-imino-1,3-thiazolidin-4-one (PubChem CID 1258938) has the molecular formula C16H9ClFN5O3S and a molecular weight of 405.80 g/mol. Its IUPAC name is (5Z)-3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methylidene]-2-imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methylidene]-2-imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1258938 |
| Molecular Formula | C16H9ClFN5O3S |
| Molecular Weight | 405.80 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | (5Z)-3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[5-(3-chloro-4-fluorophenyl)furan-2-yl]methylidene]-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(-c3ccc(F)c(Cl)c3)o2)C(=O)N1c1nonc1N |
| InChI | InChI=1S/C16H9ClFN5O3S/c17-9-5-7(1-3-10(9)18)11-4-2-8(25-11)6-12-15(24)23(16(20)27-12)14-13(19)21-26-22-14/h1-6,20H,(H2,19,21)/b12-6-,20-16- |
| InChIKey | LOVLZFKTOLDDJG-ASCCLTSKSA-N |
| XLogP | 3.76 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.80 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|