C17H10F3N5O3S — CID 4217656
3-(4-amino-1,2,5-oxadiazol-3-yl)-2-imino-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 4217656) has the molecular formula C17H10F3N5O3S and a molecular weight of 421.36 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-2-imino-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-2-imino-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4217656 |
| Molecular Formula | C17H10F3N5O3S |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-2-imino-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\SC(=Cc2ccc(-c3cccc(C(F)(F)F)c3)o2)C(=O)N1c1nonc1N |
| InChI | InChI=1S/C17H10F3N5O3S/c18-17(19,20)9-3-1-2-8(6-9)11-5-4-10(27-11)7-12-15(26)25(16(22)29-12)14-13(21)23-28-24-14/h1-7,22H,(H2,21,23)/b12-7?,22-16- |
| InChIKey | KLTFUTAMWVTLMG-IDDPJLJSSA-N |
| XLogP | 3.99 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|