C22H12F3N2O5S- — CID 6104912
3-[5-[(Z)-[2-imino-4-oxo-3-[4-(trifluoromethoxy)phenyl]-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 6104912) has the molecular formula C22H12F3N2O5S- and a molecular weight of 473.41 g/mol. Its IUPAC name is 3-[5-[(Z)-[2-imino-4-oxo-3-[4-(trifluoromethoxy)phenyl]-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | 3-[5-[(Z)-[2-imino-4-oxo-3-[4-(trifluoromethoxy)phenyl]-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 6104912 |
| Molecular Formula | C22H12F3N2O5S- |
| Molecular Weight | 473.41 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | 3-[5-[(Z)-[2-imino-4-oxo-3-[4-(trifluoromethoxy)phenyl]-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(-c3cccc(C(=O)[O-])c3)o2)C(=O)N1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C22H13F3N2O5S/c23-22(24,25)32-15-6-4-14(5-7-15)27-19(28)18(33-21(27)26)11-16-8-9-17(31-16)12-2-1-3-13(10-12)20(29)30/h1-11,26H,(H,29,30)/p-1/b18-11-,26-21- |
| InChIKey | MBJNMDBAACSSKO-HMQCCPTKSA-M |
| XLogP | 4.26 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|