C23H16F3NO4S — CID 2716248
(5E)-3-(2-phenoxyethyl)-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 2716248) has the molecular formula C23H16F3NO4S and a molecular weight of 459.45 g/mol. Its IUPAC name is (5E)-3-(2-phenoxyethyl)-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-(2-phenoxyethyl)-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2716248 |
| Molecular Formula | C23H16F3NO4S |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | (5E)-3-(2-phenoxyethyl)-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccc(-c3cccc(C(F)(F)F)c3)o2)C(=O)N1CCOc1ccccc1 |
| InChI | InChI=1S/C23H16F3NO4S/c24-23(25,26)16-6-4-5-15(13-16)19-10-9-18(31-19)14-20-21(28)27(22(29)32-20)11-12-30-17-7-2-1-3-8-17/h1-10,13-14H,11-12H2/b20-14+ |
| InChIKey | QVPVQLDYAXHCER-XSFVSMFZSA-N |
| XLogP | 6.08 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|