C21H18F3NO4S2 — CID 58644039
2-methyl-5-[(5Z)-4-oxo-2-sulfanylidene-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]pentanoic acid (PubChem CID 58644039) has the molecular formula C21H18F3NO4S2 and a molecular weight of 469.51 g/mol. Its IUPAC name is 2-methyl-5-[(5Z)-4-oxo-2-sulfanylidene-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]pentanoic acid.
| Compound Name | 2-methyl-5-[(5Z)-4-oxo-2-sulfanylidene-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 58644039 |
| Molecular Formula | C21H18F3NO4S2 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | 2-methyl-5-[(5Z)-4-oxo-2-sulfanylidene-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]pentanoic acid |
| SMILES | CC(CCCN1C(=O)/C(=C/c2ccc(-c3cccc(C(F)(F)F)c3)o2)SC1=S)C(=O)O |
| InChI | InChI=1S/C21H18F3NO4S2/c1-12(19(27)28)4-3-9-25-18(26)17(31-20(25)30)11-15-7-8-16(29-15)13-5-2-6-14(10-13)21(22,23)24/h2,5-8,10-12H,3-4,9H2,1H3,(H,27,28)/b17-11- |
| InChIKey | YOXLNAKMABQCMP-BOPFTXTBSA-N |
| XLogP | 5.67 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|