C19H14F3NO5S2 — CID 72654800
4-[4-oxo-2-sulfanylidene-5-[[5-[3-(trifluoromethoxy)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 72654800) has the molecular formula C19H14F3NO5S2 and a molecular weight of 457.45 g/mol. Its IUPAC name is 4-[4-oxo-2-sulfanylidene-5-[[5-[3-(trifluoromethoxy)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[4-oxo-2-sulfanylidene-5-[[5-[3-(trifluoromethoxy)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 72654800 |
| Molecular Formula | C19H14F3NO5S2 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | 4-[4-oxo-2-sulfanylidene-5-[[5-[3-(trifluoromethoxy)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C(=Cc2ccc(-c3cccc(OC(F)(F)F)c3)o2)SC1=S |
| InChI | InChI=1S/C19H14F3NO5S2/c20-19(21,22)28-13-4-1-3-11(9-13)14-7-6-12(27-14)10-15-17(26)23(18(29)30-15)8-2-5-16(24)25/h1,3-4,6-7,9-10H,2,5,8H2,(H,24,25) |
| InChIKey | MCFVXDFTYSKZQZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|