C21H18F3NO3S2 — CID 143009595
(5E)-3-[(Z)-2-methoxypent-2-enyl]-2-sulfanylidene-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 143009595) has the molecular formula C21H18F3NO3S2 and a molecular weight of 453.51 g/mol. Its IUPAC name is (5E)-3-[(Z)-2-methoxypent-2-enyl]-2-sulfanylidene-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-[(Z)-2-methoxypent-2-enyl]-2-sulfanylidene-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 143009595 |
| Molecular Formula | C21H18F3NO3S2 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | (5E)-3-[(Z)-2-methoxypent-2-enyl]-2-sulfanylidene-5-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CC/C=C(/CN1C(=O)/C(=C\c2ccc(-c3cccc(C(F)(F)F)c3)o2)SC1=S)OC |
| InChI | InChI=1S/C21H18F3NO3S2/c1-3-5-16(27-2)12-25-19(26)18(30-20(25)29)11-15-8-9-17(28-15)13-6-4-7-14(10-13)21(22,23)24/h4-11H,3,12H2,1-2H3/b16-5-,18-11+ |
| InChIKey | PGXFSQUBAIFTAJ-KZENCQGTSA-N |
| XLogP | 6.11 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|