C21H17ClF3NO4S2 — CID 58643782
5-[(5Z)-5-[[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-methylpentanoic acid (PubChem CID 58643782) has the molecular formula C21H17ClF3NO4S2 and a molecular weight of 503.95 g/mol. Its IUPAC name is 5-[(5Z)-5-[[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-methylpentanoic acid.
| Compound Name | 5-[(5Z)-5-[[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 58643782 |
| Molecular Formula | C21H17ClF3NO4S2 |
| Molecular Weight | 503.95 g/mol |
| Exact Mass | 503.02 |
| IUPAC Name | 5-[(5Z)-5-[[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-methylpentanoic acid |
| SMILES | CC(CCCN1C(=O)/C(=C/c2ccc(-c3cc(C(F)(F)F)ccc3Cl)o2)SC1=S)C(=O)O |
| InChI | InChI=1S/C21H17ClF3NO4S2/c1-11(19(28)29)3-2-8-26-18(27)17(32-20(26)31)10-13-5-7-16(30-13)14-9-12(21(23,24)25)4-6-15(14)22/h4-7,9-11H,2-3,8H2,1H3,(H,28,29)/b17-10- |
| InChIKey | RDZQKWIMQNIFGB-YVLHZVERSA-N |
| XLogP | 6.32 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.95 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|