C23H21ClF3N3O3S2 — CID 6197047
N-[(5Z)-5-[[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-piperidin-1-ylpropanamide (PubChem CID 6197047) has the molecular formula C23H21ClF3N3O3S2 and a molecular weight of 544.02 g/mol. Its IUPAC name is N-[(5Z)-5-[[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-piperidin-1-ylpropanamide.
| Compound Name | N-[(5Z)-5-[[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-piperidin-1-ylpropanamide |
|---|---|
| PubChem CID | 6197047 |
| Molecular Formula | C23H21ClF3N3O3S2 |
| Molecular Weight | 544.02 g/mol |
| Exact Mass | 543.07 |
| IUPAC Name | N-[(5Z)-5-[[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-piperidin-1-ylpropanamide |
| SMILES | O=C(CCN1CCCCC1)NN1C(=O)/C(=C/c2ccc(-c3cc(C(F)(F)F)ccc3Cl)o2)SC1=S |
| InChI | InChI=1S/C23H21ClF3N3O3S2/c24-17-6-4-14(23(25,26)27)12-16(17)18-7-5-15(33-18)13-19-21(32)30(22(34)35-19)28-20(31)8-11-29-9-2-1-3-10-29/h4-7,12-13H,1-3,8-11H2,(H,28,31)/b19-13- |
| InChIKey | NXAQRCCISUBKMN-UYRXBGFRSA-N |
| XLogP | 5.73 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.02 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|