C22H14Cl2N2O4S2 — CID 126355625
N-[(5E)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methoxybenzamide (PubChem CID 126355625) has the molecular formula C22H14Cl2N2O4S2 and a molecular weight of 505.40 g/mol. Its IUPAC name is N-[(5E)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methoxybenzamide.
| Compound Name | N-[(5E)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 126355625 |
| Molecular Formula | C22H14Cl2N2O4S2 |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 503.98 |
| IUPAC Name | N-[(5E)-5-[[5-(2,5-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NN2C(=O)/C(=C\c3ccc(-c4cc(Cl)ccc4Cl)o3)SC2=S)cc1 |
| InChI | InChI=1S/C22H14Cl2N2O4S2/c1-29-14-5-2-12(3-6-14)20(27)25-26-21(28)19(32-22(26)31)11-15-7-9-18(30-15)16-10-13(23)4-8-17(16)24/h2-11H,1H3,(H,25,27)/b19-11+ |
| InChIKey | RAPRRWLFGPZUBH-YBFXNURJSA-N |
| XLogP | 5.81 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|