C23H16ClN3O5S2 — CID 126341378
4-chloro-N-[(5Z)-5-[[5-(4,5-dimethyl-2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 126341378) has the molecular formula C23H16ClN3O5S2 and a molecular weight of 513.98 g/mol. Its IUPAC name is 4-chloro-N-[(5Z)-5-[[5-(4,5-dimethyl-2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 4-chloro-N-[(5Z)-5-[[5-(4,5-dimethyl-2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 126341378 |
| Molecular Formula | C23H16ClN3O5S2 |
| Molecular Weight | 513.98 g/mol |
| Exact Mass | 513.02 |
| IUPAC Name | 4-chloro-N-[(5Z)-5-[[5-(4,5-dimethyl-2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | Cc1cc(-c2ccc(/C=C3\SC(=S)N(NC(=O)c4ccc(Cl)cc4)C3=O)o2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C23H16ClN3O5S2/c1-12-9-17(18(27(30)31)10-13(12)2)19-8-7-16(32-19)11-20-22(29)26(23(33)34-20)25-21(28)14-3-5-15(24)6-4-14/h3-11H,1-2H3,(H,25,28)/b20-11- |
| InChIKey | ZQGHKKPUXHJCNX-JAIQZWGSSA-N |
| XLogP | 5.67 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.98 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|