C17H8Cl3N3O4S2 — CID 126334692
4-chloro-N-[(5Z)-5-[(2,4-dichloro-5-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 126334692) has the molecular formula C17H8Cl3N3O4S2 and a molecular weight of 488.76 g/mol. Its IUPAC name is 4-chloro-N-[(5Z)-5-[(2,4-dichloro-5-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 4-chloro-N-[(5Z)-5-[(2,4-dichloro-5-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 126334692 |
| Molecular Formula | C17H8Cl3N3O4S2 |
| Molecular Weight | 488.76 g/mol |
| Exact Mass | 486.90 |
| IUPAC Name | 4-chloro-N-[(5Z)-5-[(2,4-dichloro-5-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | O=C(NN1C(=O)/C(=C/c2cc([N+](=O)[O-])c(Cl)cc2Cl)SC1=S)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H8Cl3N3O4S2/c18-10-3-1-8(2-4-10)15(24)21-22-16(25)14(29-17(22)28)6-9-5-13(23(26)27)12(20)7-11(9)19/h1-7H,(H,21,24)/b14-6- |
| InChIKey | XJVHDBMOWNWFIZ-NSIKDUERSA-N |
| XLogP | 5.10 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.76 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|