C20H11ClN2O4S2 — CID 126354416
4-chloro-N-[(5E)-4-oxo-5-[(2-oxochromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 126354416) has the molecular formula C20H11ClN2O4S2 and a molecular weight of 442.91 g/mol. Its IUPAC name is 4-chloro-N-[(5E)-4-oxo-5-[(2-oxochromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 4-chloro-N-[(5E)-4-oxo-5-[(2-oxochromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 126354416 |
| Molecular Formula | C20H11ClN2O4S2 |
| Molecular Weight | 442.91 g/mol |
| Exact Mass | 441.98 |
| IUPAC Name | 4-chloro-N-[(5E)-4-oxo-5-[(2-oxochromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | O=C(NN1C(=O)/C(=C\c2cc3ccccc3oc2=O)SC1=S)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H11ClN2O4S2/c21-14-7-5-11(6-8-14)17(24)22-23-18(25)16(29-20(23)28)10-13-9-12-3-1-2-4-15(12)27-19(13)26/h1-10H,(H,22,24)/b16-10+ |
| InChIKey | OZZKJDGPBSLSDZ-MHWRWJLKSA-N |
| XLogP | 3.99 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.91 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|