C21H12Cl2N2O3S3 — CID 126352700
4-chloro-N-[(5Z)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 126352700) has the molecular formula C21H12Cl2N2O3S3 and a molecular weight of 507.45 g/mol. Its IUPAC name is 4-chloro-N-[(5Z)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 4-chloro-N-[(5Z)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 126352700 |
| Molecular Formula | C21H12Cl2N2O3S3 |
| Molecular Weight | 507.45 g/mol |
| Exact Mass | 505.94 |
| IUPAC Name | 4-chloro-N-[(5Z)-5-[[5-(4-chlorophenyl)sulfanylfuran-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | O=C(NN1C(=O)/C(=C/c2ccc(Sc3ccc(Cl)cc3)o2)SC1=S)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H12Cl2N2O3S3/c22-13-3-1-12(2-4-13)19(26)24-25-20(27)17(31-21(25)29)11-15-7-10-18(28-15)30-16-8-5-14(23)6-9-16/h1-11H,(H,24,26)/b17-11- |
| InChIKey | LKHVOSWMKGDNPT-BOPFTXTBSA-N |
| XLogP | 6.28 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.45 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|