C23H15ClN2O5S2 — CID 126184273
methyl 5-[5-[(E)-(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-2-chlorobenzoate (PubChem CID 126184273) has the molecular formula C23H15ClN2O5S2 and a molecular weight of 498.97 g/mol. Its IUPAC name is methyl 5-[5-[(E)-(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-2-chlorobenzoate.
| Compound Name | methyl 5-[5-[(E)-(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 126184273 |
| Molecular Formula | C23H15ClN2O5S2 |
| Molecular Weight | 498.97 g/mol |
| Exact Mass | 498.01 |
| IUPAC Name | methyl 5-[5-[(E)-(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]-2-chlorobenzoate |
| SMILES | COC(=O)c1cc(-c2ccc(/C=C3/SC(=S)N(NC(=O)c4ccccc4)C3=O)o2)ccc1Cl |
| InChI | InChI=1S/C23H15ClN2O5S2/c1-30-22(29)16-11-14(7-9-17(16)24)18-10-8-15(31-18)12-19-21(28)26(23(32)33-19)25-20(27)13-5-3-2-4-6-13/h2-12H,1H3,(H,25,27)/b19-12+ |
| InChIKey | DCXVJELOPKLZJB-XDHOZWIPSA-N |
| XLogP | 4.93 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.97 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|