C20H12N2O5S3 — CID 126219696
3-[5-[(E)-[4-oxo-2-sulfanylidene-3-(thiophene-2-carbonylamino)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 126219696) has the molecular formula C20H12N2O5S3 and a molecular weight of 456.53 g/mol. Its IUPAC name is 3-[5-[(E)-[4-oxo-2-sulfanylidene-3-(thiophene-2-carbonylamino)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 3-[5-[(E)-[4-oxo-2-sulfanylidene-3-(thiophene-2-carbonylamino)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126219696 |
| Molecular Formula | C20H12N2O5S3 |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 455.99 |
| IUPAC Name | 3-[5-[(E)-[4-oxo-2-sulfanylidene-3-(thiophene-2-carbonylamino)-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2ccc(/C=C3/SC(=S)N(NC(=O)c4cccs4)C3=O)o2)c1 |
| InChI | InChI=1S/C20H12N2O5S3/c23-17(15-5-2-8-29-15)21-22-18(24)16(30-20(22)28)10-13-6-7-14(27-13)11-3-1-4-12(9-11)19(25)26/h1-10H,(H,21,23)(H,25,26)/b16-10+ |
| InChIKey | PETKZQGHDZVNBO-MHWRWJLKSA-N |
| XLogP | 4.25 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|