C19H15ClN2OS — CID 16633322
(5Z)-3-(4-chlorophenyl)-2-imino-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one (PubChem CID 16633322) has the molecular formula C19H15ClN2OS and a molecular weight of 354.86 g/mol. Its IUPAC name is (5Z)-3-(4-chlorophenyl)-2-imino-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(4-chlorophenyl)-2-imino-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16633322 |
| Molecular Formula | C19H15ClN2OS |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | (5Z)-3-(4-chlorophenyl)-2-imino-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\S/C(=C\C(C)=C\c2ccccc2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H15ClN2OS/c1-13(11-14-5-3-2-4-6-14)12-17-18(23)22(19(21)24-17)16-9-7-15(20)8-10-16/h2-12,21H,1H3/b13-11+,17-12-,21-19- |
| InChIKey | VYOOXHORAVRDQS-MDAUIUCBSA-N |
| XLogP | 5.34 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|