C20H21N3O3S2 — CID 16633484
4-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-2-imino-4-oxo-1,3-thiazolidin-3-yl]benzenesulfonamide (PubChem CID 16633484) has the molecular formula C20H21N3O3S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 4-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-2-imino-4-oxo-1,3-thiazolidin-3-yl]benzenesulfonamide.
| Compound Name | 4-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-2-imino-4-oxo-1,3-thiazolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 16633484 |
| Molecular Formula | C20H21N3O3S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 4-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-2-imino-4-oxo-1,3-thiazolidin-3-yl]benzenesulfonamide |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(C(C)(C)C)cc2)C(=O)N1c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H21N3O3S2/c1-20(2,3)14-6-4-13(5-7-14)12-17-18(24)23(19(21)27-17)15-8-10-16(11-9-15)28(22,25)26/h4-12,21H,1-3H3,(H2,22,25,26)/b17-12-,21-19- |
| InChIKey | LQLUNLGPGTZMOR-WJCPARMISA-N |
| XLogP | 3.69 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|