C14H11N3O4S2 — CID 16633519
4-[(5Z)-5-(furan-2-ylmethylidene)-2-imino-4-oxo-1,3-thiazolidin-3-yl]benzenesulfonamide (PubChem CID 16633519) has the molecular formula C14H11N3O4S2 and a molecular weight of 349.39 g/mol. Its IUPAC name is 4-[(5Z)-5-(furan-2-ylmethylidene)-2-imino-4-oxo-1,3-thiazolidin-3-yl]benzenesulfonamide.
| Compound Name | 4-[(5Z)-5-(furan-2-ylmethylidene)-2-imino-4-oxo-1,3-thiazolidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 16633519 |
| Molecular Formula | C14H11N3O4S2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 4-[(5Z)-5-(furan-2-ylmethylidene)-2-imino-4-oxo-1,3-thiazolidin-3-yl]benzenesulfonamide |
| SMILES | [H]/N=C1\S/C(=C\c2ccco2)C(=O)N1c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C14H11N3O4S2/c15-14-17(9-3-5-11(6-4-9)23(16,19)20)13(18)12(22-14)8-10-2-1-7-21-10/h1-8,15H,(H2,16,19,20)/b12-8-,15-14- |
| InChIKey | GQNAGBWURQNFSZ-YHININJHSA-N |
| XLogP | 1.98 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|