C11H8N4O2S2 — CID 2176068
(5Z)-5-(furan-2-ylmethylidene)-2-imino-3-(5-methyl-1,3,4-thiadiazol-2-yl)-1,3-thiazolidin-4-one (PubChem CID 2176068) has the molecular formula C11H8N4O2S2 and a molecular weight of 292.34 g/mol. Its IUPAC name is (5Z)-5-(furan-2-ylmethylidene)-2-imino-3-(5-methyl-1,3,4-thiadiazol-2-yl)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-(furan-2-ylmethylidene)-2-imino-3-(5-methyl-1,3,4-thiadiazol-2-yl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2176068 |
| Molecular Formula | C11H8N4O2S2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | (5Z)-5-(furan-2-ylmethylidene)-2-imino-3-(5-methyl-1,3,4-thiadiazol-2-yl)-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\S/C(=C\c2ccco2)C(=O)N1c1nnc(C)s1 |
| InChI | InChI=1S/C11H8N4O2S2/c1-6-13-14-11(18-6)15-9(16)8(19-10(15)12)5-7-3-2-4-17-7/h2-5,12H,1H3/b8-5-,12-10- |
| InChIKey | XAOXQSYKBVMLSW-TVYVFBHLSA-N |
| XLogP | 2.50 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|