C16H12N6OS2 — CID 91125086
2-imino-5-[[5-(3-methylphenyl)-1H-pyrazol-4-yl]methylidene]-3-(1,3,4-thiadiazol-2-yl)-1,3-thiazolidin-4-one (PubChem CID 91125086) has the molecular formula C16H12N6OS2 and a molecular weight of 368.45 g/mol. Its IUPAC name is 2-imino-5-[[5-(3-methylphenyl)-1H-pyrazol-4-yl]methylidene]-3-(1,3,4-thiadiazol-2-yl)-1,3-thiazolidin-4-one.
| Compound Name | 2-imino-5-[[5-(3-methylphenyl)-1H-pyrazol-4-yl]methylidene]-3-(1,3,4-thiadiazol-2-yl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 91125086 |
| Molecular Formula | C16H12N6OS2 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 2-imino-5-[[5-(3-methylphenyl)-1H-pyrazol-4-yl]methylidene]-3-(1,3,4-thiadiazol-2-yl)-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\SC(=Cc2cn[nH]c2-c2cccc(C)c2)C(=O)N1c1nncs1 |
| InChI | InChI=1S/C16H12N6OS2/c1-9-3-2-4-10(5-9)13-11(7-18-20-13)6-12-14(23)22(15(17)25-12)16-21-19-8-24-16/h2-8,17H,1H3,(H,18,20)/b12-6?,17-15- |
| InChIKey | MWSXBZQYBBENAU-KNBUFKHESA-N |
| XLogP | 3.29 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|