C13H10N4OS — CID 171128182
2-imino-5-[(5-phenyl-1H-pyrazol-4-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 171128182) has the molecular formula C13H10N4OS and a molecular weight of 270.32 g/mol. Its IUPAC name is 2-imino-5-[(5-phenyl-1H-pyrazol-4-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-imino-5-[(5-phenyl-1H-pyrazol-4-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 171128182 |
| Molecular Formula | C13H10N4OS |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 2-imino-5-[(5-phenyl-1H-pyrazol-4-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1/NC(=O)C(=Cc2cn[nH]c2-c2ccccc2)S1 |
| InChI | InChI=1S/C13H10N4OS/c14-13-16-12(18)10(19-13)6-9-7-15-17-11(9)8-4-2-1-3-5-8/h1-7H,(H,15,17)(H2,14,16,18) |
| InChIKey | MGFUXLRKCOWYPD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|