C19H20N4O2S — CID 7066302
(5Z)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-[(5-phenyl-1H-pyrazol-4-yl)methylidene]-1,3-thiazol-4-one (PubChem CID 7066302) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is (5Z)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-[(5-phenyl-1H-pyrazol-4-yl)methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-[(5-phenyl-1H-pyrazol-4-yl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 7066302 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (5Z)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-[(5-phenyl-1H-pyrazol-4-yl)methylidene]-1,3-thiazol-4-one |
| SMILES | C[C@@H]1CN(C2=NC(=O)/C(=C/c3cn[nH]c3-c3ccccc3)S2)C[C@@H](C)O1 |
| InChI | InChI=1S/C19H20N4O2S/c1-12-10-23(11-13(2)25-12)19-21-18(24)16(26-19)8-15-9-20-22-17(15)14-6-4-3-5-7-14/h3-9,12-13H,10-11H2,1-2H3,(H,20,22)/b16-8-/t12-,13-/m1/s1 |
| InChIKey | CUBAANKEPOUECM-DKMDKWEQSA-N |
| XLogP | 3.16 |
| TPSA | 70.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|