C14H11ClN4OS — CID 138376612
(5Z)-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-2-imino-1,3-thiazolidin-4-one (PubChem CID 138376612) has the molecular formula C14H11ClN4OS and a molecular weight of 318.79 g/mol. Its IUPAC name is (5Z)-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-2-imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-2-imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 138376612 |
| Molecular Formula | C14H11ClN4OS |
| Molecular Weight | 318.79 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | (5Z)-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\NC(=O)/C(=C/c2c(C)nn(-c3ccccc3)c2Cl)S1 |
| InChI | InChI=1S/C14H11ClN4OS/c1-8-10(7-11-13(20)17-14(16)21-11)12(15)19(18-8)9-5-3-2-4-6-9/h2-7H,1H3,(H2,16,17,20)/b11-7- |
| InChIKey | GMQPKCSKCODVAV-XFFZJAGNSA-N |
| XLogP | 2.97 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.79 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_D(8)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|