C27H20ClN5O2 — CID 155809565
(5Z)-2-benzoyl-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-3-phenyl-1H-1,2,4-triazin-6-one (PubChem CID 155809565) has the molecular formula C27H20ClN5O2 and a molecular weight of 481.94 g/mol. Its IUPAC name is (5Z)-2-benzoyl-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-3-phenyl-1H-1,2,4-triazin-6-one.
| Compound Name | (5Z)-2-benzoyl-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-3-phenyl-1H-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 155809565 |
| Molecular Formula | C27H20ClN5O2 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | (5Z)-2-benzoyl-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-3-phenyl-1H-1,2,4-triazin-6-one |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1/C=C1\N=C(c2ccccc2)N(C(=O)c2ccccc2)NC1=O |
| InChI | InChI=1S/C27H20ClN5O2/c1-18-22(24(28)32(30-18)21-15-9-4-10-16-21)17-23-26(34)31-33(27(35)20-13-7-3-8-14-20)25(29-23)19-11-5-2-6-12-19/h2-17H,1H3,(H,31,34)/b23-17- |
| InChIKey | HBHLGKXNCAEKLY-QJOMJCCJSA-N |
| XLogP | 4.81 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_D(1)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|