C21H16ClN3OS — CID 56687987
(5E)-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-2-(4-methylphenyl)-1,3-thiazol-4-one (PubChem CID 56687987) has the molecular formula C21H16ClN3OS and a molecular weight of 393.90 g/mol. Its IUPAC name is (5E)-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-2-(4-methylphenyl)-1,3-thiazol-4-one.
| Compound Name | (5E)-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-2-(4-methylphenyl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 56687987 |
| Molecular Formula | C21H16ClN3OS |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | (5E)-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-2-(4-methylphenyl)-1,3-thiazol-4-one |
| SMILES | Cc1ccc(C2=NC(=O)/C(=C\c3c(C)nn(-c4ccccc4)c3Cl)S2)cc1 |
| InChI | InChI=1S/C21H16ClN3OS/c1-13-8-10-15(11-9-13)21-23-20(26)18(27-21)12-17-14(2)24-25(19(17)22)16-6-4-3-5-7-16/h3-12H,1-2H3/b18-12+ |
| InChIKey | CBAMWRBGVZDRSK-LDADJPATSA-N |
| XLogP | 5.20 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|