C17H14N4O2 — CID 139227892
(5Z)-5-benzylidene-6-oxo-3-phenyl-1H-1,2,4-triazine-2-carboxamide (PubChem CID 139227892) has the molecular formula C17H14N4O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is (5Z)-5-benzylidene-6-oxo-3-phenyl-1H-1,2,4-triazine-2-carboxamide.
| Compound Name | (5Z)-5-benzylidene-6-oxo-3-phenyl-1H-1,2,4-triazine-2-carboxamide |
|---|---|
| PubChem CID | 139227892 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | (5Z)-5-benzylidene-6-oxo-3-phenyl-1H-1,2,4-triazine-2-carboxamide |
| SMILES | NC(=O)N1NC(=O)/C(=C/c2ccccc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C17H14N4O2/c18-17(23)21-15(13-9-5-2-6-10-13)19-14(16(22)20-21)11-12-7-3-1-4-8-12/h1-11H,(H2,18,23)(H,20,22)/b14-11- |
| InChIKey | AGRGJYCKQOFWMF-KAMYIIQDSA-N |
| XLogP | 1.90 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_six_het_D(1)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|