C22H17N3O — CID 6085341
(5E)-5-benzylidene-1,3-diphenyl-2H-1,2,4-triazin-6-one (PubChem CID 6085341) has the molecular formula C22H17N3O and a molecular weight of 339.40 g/mol. Its IUPAC name is (5E)-5-benzylidene-1,3-diphenyl-2H-1,2,4-triazin-6-one.
| Compound Name | (5E)-5-benzylidene-1,3-diphenyl-2H-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 6085341 |
| Molecular Formula | C22H17N3O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | (5E)-5-benzylidene-1,3-diphenyl-2H-1,2,4-triazin-6-one |
| SMILES | O=C1/C(=C\c2ccccc2)N=C(c2ccccc2)NN1c1ccccc1 |
| InChI | InChI=1S/C22H17N3O/c26-22-20(16-17-10-4-1-5-11-17)23-21(18-12-6-2-7-13-18)24-25(22)19-14-8-3-9-15-19/h1-16H,(H,23,24)/b20-16+ |
| InChIKey | VGXSTUAMDJLTCR-CAPFRKAQSA-N |
| XLogP | 4.03 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_six_het_D(1)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|