C24H18BrN3O3 — CID 155814411
(5Z)-5-[(4-bromophenyl)methylidene]-2-(4-methoxybenzoyl)-3-phenyl-1H-1,2,4-triazin-6-one (PubChem CID 155814411) has the molecular formula C24H18BrN3O3 and a molecular weight of 476.33 g/mol. Its IUPAC name is (5Z)-5-[(4-bromophenyl)methylidene]-2-(4-methoxybenzoyl)-3-phenyl-1H-1,2,4-triazin-6-one.
| Compound Name | (5Z)-5-[(4-bromophenyl)methylidene]-2-(4-methoxybenzoyl)-3-phenyl-1H-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 155814411 |
| Molecular Formula | C24H18BrN3O3 |
| Molecular Weight | 476.33 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | (5Z)-5-[(4-bromophenyl)methylidene]-2-(4-methoxybenzoyl)-3-phenyl-1H-1,2,4-triazin-6-one |
| SMILES | COc1ccc(C(=O)N2NC(=O)/C(=C/c3ccc(Br)cc3)N=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C24H18BrN3O3/c1-31-20-13-9-18(10-14-20)24(30)28-22(17-5-3-2-4-6-17)26-21(23(29)27-28)15-16-7-11-19(25)12-8-16/h2-15H,1H3,(H,27,29)/b21-15- |
| InChIKey | DMRKQOROLLVFCC-QNGOZBTKSA-N |
| XLogP | 4.43 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_D(1)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|