C27H18ClN7O6 — CID 155814010
(5Z)-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-2-(3,5-dinitrobenzoyl)-3-phenyl-1H-1,2,4-triazin-6-one (PubChem CID 155814010) has the molecular formula C27H18ClN7O6 and a molecular weight of 571.94 g/mol. Its IUPAC name is (5Z)-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-2-(3,5-dinitrobenzoyl)-3-phenyl-1H-1,2,4-triazin-6-one.
| Compound Name | (5Z)-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-2-(3,5-dinitrobenzoyl)-3-phenyl-1H-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 155814010 |
| Molecular Formula | C27H18ClN7O6 |
| Molecular Weight | 571.94 g/mol |
| Exact Mass | 571.10 |
| IUPAC Name | (5Z)-5-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]-2-(3,5-dinitrobenzoyl)-3-phenyl-1H-1,2,4-triazin-6-one |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1/C=C1\N=C(c2ccccc2)N(C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)NC1=O |
| InChI | InChI=1S/C27H18ClN7O6/c1-16-22(24(28)32(30-16)19-10-6-3-7-11-19)15-23-26(36)31-33(25(29-23)17-8-4-2-5-9-17)27(37)18-12-20(34(38)39)14-21(13-18)35(40)41/h2-15H,1H3,(H,31,36)/b23-15- |
| InChIKey | DYSQPGCVKIOVNR-HAHDFKILSA-N |
| XLogP | 4.63 |
| TPSA | 165.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.94 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_D(1)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|