C11H5N5O6S2 — CID 164609649
(5Z)-2-imino-5-[(4-nitrofuran-2-yl)methylidene]-3-(5-nitro-1,3-thiazol-2-yl)-1,3-thiazolidin-4-one (PubChem CID 164609649) has the molecular formula C11H5N5O6S2 and a molecular weight of 367.32 g/mol. Its IUPAC name is (5Z)-2-imino-5-[(4-nitrofuran-2-yl)methylidene]-3-(5-nitro-1,3-thiazol-2-yl)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-imino-5-[(4-nitrofuran-2-yl)methylidene]-3-(5-nitro-1,3-thiazol-2-yl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 164609649 |
| Molecular Formula | C11H5N5O6S2 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | (5Z)-2-imino-5-[(4-nitrofuran-2-yl)methylidene]-3-(5-nitro-1,3-thiazol-2-yl)-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\S/C(=C\c2cc([N+](=O)[O-])co2)C(=O)N1c1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C11H5N5O6S2/c12-10-14(11-13-3-8(24-11)16(20)21)9(17)7(23-10)2-6-1-5(4-22-6)15(18)19/h1-4,12H/b7-2-,12-10- |
| InChIKey | RZSWPVDJOGCVPV-PFFHPPHTSA-N |
| XLogP | 2.61 |
| TPSA | 156.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|