C20H13Cl2N3OS2 — CID 2004199
(5Z)-5-[(4-chlorophenyl)methylidene]-3-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-imino-1,3-thiazolidin-4-one (PubChem CID 2004199) has the molecular formula C20H13Cl2N3OS2 and a molecular weight of 446.38 g/mol. Its IUPAC name is (5Z)-5-[(4-chlorophenyl)methylidene]-3-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(4-chlorophenyl)methylidene]-3-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2004199 |
| Molecular Formula | C20H13Cl2N3OS2 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 444.99 |
| IUPAC Name | (5Z)-5-[(4-chlorophenyl)methylidene]-3-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(Cl)cc2)C(=O)N1c1ncc(Cc2ccccc2Cl)s1 |
| InChI | InChI=1S/C20H13Cl2N3OS2/c21-14-7-5-12(6-8-14)9-17-18(26)25(19(23)28-17)20-24-11-15(27-20)10-13-3-1-2-4-16(13)22/h1-9,11,23H,10H2/b17-9-,23-19- |
| InChIKey | MVKUKLGZBHSCFG-UPBOQZGBSA-N |
| XLogP | 6.10 |
| TPSA | 57.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|