C18H16N4O5 — CID 10067588
4,4-dimethyl-5-methylidene-1,3-bis(4-nitrophenyl)imidazolidin-2-one (PubChem CID 10067588) has the molecular formula C18H16N4O5 and a molecular weight of 368.35 g/mol. Its IUPAC name is 4,4-dimethyl-5-methylidene-1,3-bis(4-nitrophenyl)imidazolidin-2-one.
| Compound Name | 4,4-dimethyl-5-methylidene-1,3-bis(4-nitrophenyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 10067588 |
| Molecular Formula | C18H16N4O5 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 4,4-dimethyl-5-methylidene-1,3-bis(4-nitrophenyl)imidazolidin-2-one |
| SMILES | C=C1N(c2ccc([N+](=O)[O-])cc2)C(=O)N(c2ccc([N+](=O)[O-])cc2)C1(C)C |
| InChI | InChI=1S/C18H16N4O5/c1-12-18(2,3)20(14-6-10-16(11-7-14)22(26)27)17(23)19(12)13-4-8-15(9-5-13)21(24)25/h4-11H,1H2,2-3H3 |
| InChIKey | GVQKKSABRWBINY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|