C12H16N2O10 — CID 143764296
ethane;2,2,5,5,6,6-hexahydroxy-4-(4-nitrophenyl)morpholin-3-one (PubChem CID 143764296) has the molecular formula C12H16N2O10 and a molecular weight of 348.26 g/mol. Its IUPAC name is ethane;2,2,5,5,6,6-hexahydroxy-4-(4-nitrophenyl)morpholin-3-one.
| Compound Name | ethane;2,2,5,5,6,6-hexahydroxy-4-(4-nitrophenyl)morpholin-3-one |
|---|---|
| PubChem CID | 143764296 |
| Molecular Formula | C12H16N2O10 |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | ethane;2,2,5,5,6,6-hexahydroxy-4-(4-nitrophenyl)morpholin-3-one |
| SMILES | CC.O=C1N(c2ccc([N+](=O)[O-])cc2)C(O)(O)C(O)(O)OC1(O)O |
| InChI | InChI=1S/C10H10N2O10.C2H6/c13-7-8(14,15)22-10(18,19)9(16,17)11(7)5-1-3-6(4-2-5)12(20)21;1-2/h1-4,14-19H;1-2H3 |
| InChIKey | AGPQWLBFRSSXTM-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 194.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|