C18H28N2O3 — CID 118584178
2,2,3,3,5,5,6,6-octamethyl-4-(4-nitrophenyl)morpholine (PubChem CID 118584178) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6-octamethyl-4-(4-nitrophenyl)morpholine.
| Compound Name | 2,2,3,3,5,5,6,6-octamethyl-4-(4-nitrophenyl)morpholine |
|---|---|
| PubChem CID | 118584178 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 2,2,3,3,5,5,6,6-octamethyl-4-(4-nitrophenyl)morpholine |
| SMILES | CC1(C)OC(C)(C)C(C)(C)N(c2ccc([N+](=O)[O-])cc2)C1(C)C |
| InChI | InChI=1S/C18H28N2O3/c1-15(2)17(5,6)23-18(7,8)16(3,4)19(15)13-9-11-14(12-10-13)20(21)22/h9-12H,1-8H3 |
| InChIKey | SRXNCHNDXSKTMU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|